C21H23IO8 — CID 86610529
methyl 2-[2-iodo-6-(4-methoxybenzoyl)-3,5-bis(methoxymethoxy)phenyl]acetate (PubChem CID 86610529) has the molecular formula C21H23IO8 and a molecular weight of 530.31 g/mol. Its IUPAC name is methyl 2-[2-iodo-6-(4-methoxybenzoyl)-3,5-bis(methoxymethoxy)phenyl]acetate.
| Compound Name | methyl 2-[2-iodo-6-(4-methoxybenzoyl)-3,5-bis(methoxymethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 86610529 |
| Molecular Formula | C21H23IO8 |
| Molecular Weight | 530.31 g/mol |
| Exact Mass | 530.04 |
| IUPAC Name | methyl 2-[2-iodo-6-(4-methoxybenzoyl)-3,5-bis(methoxymethoxy)phenyl]acetate |
| SMILES | COCOc1cc(OCOC)c(C(=O)c2ccc(OC)cc2)c(CC(=O)OC)c1I |
| InChI | InChI=1S/C21H23IO8/c1-25-11-29-16-10-17(30-12-26-2)20(22)15(9-18(23)28-4)19(16)21(24)13-5-7-14(27-3)8-6-13/h5-8,10H,9,11-12H2,1-4H3 |
| InChIKey | RYCNGBXVTPIIKZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|