C25H28O6 — CID 87446533
methyl 2-[2-ethyl-6-(4-methoxybenzoyl)-3,5-bis(prop-2-enoxy)phenyl]acetate (PubChem CID 87446533) has the molecular formula C25H28O6 and a molecular weight of 424.49 g/mol. Its IUPAC name is methyl 2-[2-ethyl-6-(4-methoxybenzoyl)-3,5-bis(prop-2-enoxy)phenyl]acetate.
| Compound Name | methyl 2-[2-ethyl-6-(4-methoxybenzoyl)-3,5-bis(prop-2-enoxy)phenyl]acetate |
|---|---|
| PubChem CID | 87446533 |
| Molecular Formula | C25H28O6 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | methyl 2-[2-ethyl-6-(4-methoxybenzoyl)-3,5-bis(prop-2-enoxy)phenyl]acetate |
| SMILES | C=CCOc1cc(OCC=C)c(C(=O)c2ccc(OC)cc2)c(CC(=O)OC)c1CC |
| InChI | InChI=1S/C25H28O6/c1-6-13-30-21-16-22(31-14-7-2)24(20(19(21)8-3)15-23(26)29-5)25(27)17-9-11-18(28-4)12-10-17/h6-7,9-12,16H,1-2,8,13-15H2,3-5H3 |
| InChIKey | ZRZFFXCLPFEUMM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|