C25H28O6 — CID 69000623
2-[2-ethyl-3,5-bis(prop-2-enoxy)phenyl]-3-(4-methoxyphenyl)-2-methyl-3-oxopropanoic acid (PubChem CID 69000623) has the molecular formula C25H28O6 and a molecular weight of 424.49 g/mol. Its IUPAC name is 2-[2-ethyl-3,5-bis(prop-2-enoxy)phenyl]-3-(4-methoxyphenyl)-2-methyl-3-oxopropanoic acid.
| Compound Name | 2-[2-ethyl-3,5-bis(prop-2-enoxy)phenyl]-3-(4-methoxyphenyl)-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 69000623 |
| Molecular Formula | C25H28O6 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 2-[2-ethyl-3,5-bis(prop-2-enoxy)phenyl]-3-(4-methoxyphenyl)-2-methyl-3-oxopropanoic acid |
| SMILES | C=CCOc1cc(OCC=C)c(CC)c(C(C)(C(=O)O)C(=O)c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C25H28O6/c1-6-13-30-19-15-21(20(8-3)22(16-19)31-14-7-2)25(4,24(27)28)23(26)17-9-11-18(29-5)12-10-17/h6-7,9-12,15-16H,1-2,8,13-14H2,3-5H3,(H,27,28) |
| InChIKey | JPWMEFUDKIBYIC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|