C26H30O7 — CID 23116431
methyl 3-(3,4-dimethoxyphenyl)-2-[2-ethyl-3,5-bis(prop-2-enoxy)phenyl]-3-oxopropanoate (PubChem CID 23116431) has the molecular formula C26H30O7 and a molecular weight of 454.52 g/mol. Its IUPAC name is methyl 3-(3,4-dimethoxyphenyl)-2-[2-ethyl-3,5-bis(prop-2-enoxy)phenyl]-3-oxopropanoate.
| Compound Name | methyl 3-(3,4-dimethoxyphenyl)-2-[2-ethyl-3,5-bis(prop-2-enoxy)phenyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 23116431 |
| Molecular Formula | C26H30O7 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | methyl 3-(3,4-dimethoxyphenyl)-2-[2-ethyl-3,5-bis(prop-2-enoxy)phenyl]-3-oxopropanoate |
| SMILES | C=CCOc1cc(OCC=C)c(CC)c(C(C(=O)OC)C(=O)c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C26H30O7/c1-7-12-32-18-15-20(19(9-3)22(16-18)33-13-8-2)24(26(28)31-6)25(27)17-10-11-21(29-4)23(14-17)30-5/h7-8,10-11,14-16,24H,1-2,9,12-13H2,3-6H3 |
| InChIKey | VSGWLDZQEOKYIG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|