C25H28O7 — CID 23116186
3-(3,4-dimethoxyphenyl)-2-[2-ethyl-3,5-bis(prop-2-enoxy)phenyl]-3-oxopropanoic acid (PubChem CID 23116186) has the molecular formula C25H28O7 and a molecular weight of 440.49 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-2-[2-ethyl-3,5-bis(prop-2-enoxy)phenyl]-3-oxopropanoic acid.
| Compound Name | 3-(3,4-dimethoxyphenyl)-2-[2-ethyl-3,5-bis(prop-2-enoxy)phenyl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 23116186 |
| Molecular Formula | C25H28O7 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-2-[2-ethyl-3,5-bis(prop-2-enoxy)phenyl]-3-oxopropanoic acid |
| SMILES | C=CCOc1cc(OCC=C)c(CC)c(C(C(=O)O)C(=O)c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C25H28O7/c1-6-11-31-17-14-19(18(8-3)21(15-17)32-12-7-2)23(25(27)28)24(26)16-9-10-20(29-4)22(13-16)30-5/h6-7,9-10,13-15,23H,1-2,8,11-12H2,3-5H3,(H,27,28) |
| InChIKey | YSTVJWVEKBQPCG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|