C17H24N2O4 — CID 27861011
3-methoxy-N-[(2S)-1-oxo-1-(propylamino)propan-2-yl]-4-prop-2-enoxybenzamide (PubChem CID 27861011) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3-methoxy-N-[(2S)-1-oxo-1-(propylamino)propan-2-yl]-4-prop-2-enoxybenzamide.
| Compound Name | 3-methoxy-N-[(2S)-1-oxo-1-(propylamino)propan-2-yl]-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 27861011 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 3-methoxy-N-[(2S)-1-oxo-1-(propylamino)propan-2-yl]-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)N[C@@H](C)C(=O)NCCC)cc1OC |
| InChI | InChI=1S/C17H24N2O4/c1-5-9-18-16(20)12(3)19-17(21)13-7-8-14(23-10-6-2)15(11-13)22-4/h6-8,11-12H,2,5,9-10H2,1,3-4H3,(H,18,20)(H,19,21)/t12-/m0/s1 |
| InChIKey | NHQHTBNUKMTGPG-LBPRGKRZSA-N |
| XLogP | 1.90 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|