C16H24N2O5 — CID 8733093
2,4,5-trimethoxy-N-[(2S)-1-oxo-1-(propylamino)propan-2-yl]benzamide (PubChem CID 8733093) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2,4,5-trimethoxy-N-[(2S)-1-oxo-1-(propylamino)propan-2-yl]benzamide.
| Compound Name | 2,4,5-trimethoxy-N-[(2S)-1-oxo-1-(propylamino)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 8733093 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 2,4,5-trimethoxy-N-[(2S)-1-oxo-1-(propylamino)propan-2-yl]benzamide |
| SMILES | CCCNC(=O)[C@H](C)NC(=O)c1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C16H24N2O5/c1-6-7-17-15(19)10(2)18-16(20)11-8-13(22-4)14(23-5)9-12(11)21-3/h8-10H,6-7H2,1-5H3,(H,17,19)(H,18,20)/t10-/m0/s1 |
| InChIKey | XPVVVGGQAGONIG-JTQLQIEISA-N |
| XLogP | 1.36 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |