C32H43NO9 — CID 23116290
2-[2-ethyl-6-[3-methoxy-4-(2-methoxyethoxy)benzoyl]-3,5-bis(prop-2-enoxy)phenyl]-N-(2-hydroxyethyl)-N-(2-methoxyethyl)acetamide (PubChem CID 23116290) has the molecular formula C32H43NO9 and a molecular weight of 585.69 g/mol. Its IUPAC name is 2-[2-ethyl-6-[3-methoxy-4-(2-methoxyethoxy)benzoyl]-3,5-bis(prop-2-enoxy)phenyl]-N-(2-hydroxyethyl)-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[2-ethyl-6-[3-methoxy-4-(2-methoxyethoxy)benzoyl]-3,5-bis(prop-2-enoxy)phenyl]-N-(2-hydroxyethyl)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 23116290 |
| Molecular Formula | C32H43NO9 |
| Molecular Weight | 585.69 g/mol |
| Exact Mass | 585.29 |
| IUPAC Name | 2-[2-ethyl-6-[3-methoxy-4-(2-methoxyethoxy)benzoyl]-3,5-bis(prop-2-enoxy)phenyl]-N-(2-hydroxyethyl)-N-(2-methoxyethyl)acetamide |
| SMILES | C=CCOc1cc(OCC=C)c(C(=O)c2ccc(OCCOC)c(OC)c2)c(CC(=O)N(CCO)CCOC)c1CC |
| InChI | InChI=1S/C32H43NO9/c1-7-15-40-27-22-29(41-16-8-2)31(25(24(27)9-3)21-30(35)33(12-14-34)13-17-37-4)32(36)23-10-11-26(28(20-23)39-6)42-19-18-38-5/h7-8,10-11,20,22,34H,1-2,9,12-19,21H2,3-6H3 |
| InChIKey | ZCCBBFXYPJILQI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.69 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|