C30H37NO8 — CID 87447843
2-[2-ethyl-6-[4-methoxy-3-(2-morpholin-4-ylethoxy)benzoyl]-3,5-bis(prop-2-enoxy)phenyl]acetic acid (PubChem CID 87447843) has the molecular formula C30H37NO8 and a molecular weight of 539.63 g/mol. Its IUPAC name is 2-[2-ethyl-6-[4-methoxy-3-(2-morpholin-4-ylethoxy)benzoyl]-3,5-bis(prop-2-enoxy)phenyl]acetic acid.
| Compound Name | 2-[2-ethyl-6-[4-methoxy-3-(2-morpholin-4-ylethoxy)benzoyl]-3,5-bis(prop-2-enoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 87447843 |
| Molecular Formula | C30H37NO8 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | 2-[2-ethyl-6-[4-methoxy-3-(2-morpholin-4-ylethoxy)benzoyl]-3,5-bis(prop-2-enoxy)phenyl]acetic acid |
| SMILES | C=CCOc1cc(OCC=C)c(C(=O)c2ccc(OC)c(OCCN3CCOCC3)c2)c(CC(=O)O)c1CC |
| InChI | InChI=1S/C30H37NO8/c1-5-13-37-25-20-27(38-14-6-2)29(23(19-28(32)33)22(25)7-3)30(34)21-8-9-24(35-4)26(18-21)39-17-12-31-10-15-36-16-11-31/h5-6,8-9,18,20H,1-2,7,10-17,19H2,3-4H3,(H,32,33) |
| InChIKey | QSCOBFDKBFOLEJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|