C7H3F3I2O — CID 118836171
1-(difluoromethoxy)-4-fluoro-2,3-diiodobenzene (PubChem CID 118836171) has the molecular formula C7H3F3I2O and a molecular weight of 413.90 g/mol. Its IUPAC name is 1-(difluoromethoxy)-4-fluoro-2,3-diiodobenzene.
| Compound Name | 1-(difluoromethoxy)-4-fluoro-2,3-diiodobenzene |
|---|---|
| PubChem CID | 118836171 |
| Molecular Formula | C7H3F3I2O |
| Molecular Weight | 413.90 g/mol |
| Exact Mass | 413.82 |
| IUPAC Name | 1-(difluoromethoxy)-4-fluoro-2,3-diiodobenzene |
| SMILES | Fc1ccc(OC(F)F)c(I)c1I |
| InChI | InChI=1S/C7H3F3I2O/c8-3-1-2-4(13-7(9)10)6(12)5(3)11/h1-2,7H |
| InChIKey | MCRSTKYJTXGQTG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.90 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|