C9H8F4O — CID 131093585
1-(difluoromethoxy)-2-ethyl-3,4-difluorobenzene (PubChem CID 131093585) has the molecular formula C9H8F4O and a molecular weight of 208.15 g/mol. Its IUPAC name is 1-(difluoromethoxy)-2-ethyl-3,4-difluorobenzene.
| Compound Name | 1-(difluoromethoxy)-2-ethyl-3,4-difluorobenzene |
|---|---|
| PubChem CID | 131093585 |
| Molecular Formula | C9H8F4O |
| Molecular Weight | 208.15 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 1-(difluoromethoxy)-2-ethyl-3,4-difluorobenzene |
| SMILES | CCc1c(OC(F)F)ccc(F)c1F |
| InChI | InChI=1S/C9H8F4O/c1-2-5-7(14-9(12)13)4-3-6(10)8(5)11/h3-4,9H,2H2,1H3 |
| InChIKey | WHFLYFVHCQUJDW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.15 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |