C8H7F4NO — CID 130934033
[3-(difluoromethoxy)-2,6-difluorophenyl]methanamine (PubChem CID 130934033) has the molecular formula C8H7F4NO and a molecular weight of 209.14 g/mol. Its IUPAC name is [3-(difluoromethoxy)-2,6-difluorophenyl]methanamine.
| Compound Name | [3-(difluoromethoxy)-2,6-difluorophenyl]methanamine |
|---|---|
| PubChem CID | 130934033 |
| Molecular Formula | C8H7F4NO |
| Molecular Weight | 209.14 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | [3-(difluoromethoxy)-2,6-difluorophenyl]methanamine |
| SMILES | NCc1c(F)ccc(OC(F)F)c1F |
| InChI | InChI=1S/C8H7F4NO/c9-5-1-2-6(14-8(11)12)7(10)4(5)3-13/h1-2,8H,3,13H2 |
| InChIKey | NQWMLIJAQAWBHT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.14 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |