C8H6BClF2O3 — CID 142601923
5-chloro-4-(difluoromethoxy)-1-hydroxy-3H-2,1-benzoxaborole (PubChem CID 142601923) has the molecular formula C8H6BClF2O3 and a molecular weight of 234.39 g/mol. Its IUPAC name is 5-chloro-4-(difluoromethoxy)-1-hydroxy-3H-2,1-benzoxaborole.
| Compound Name | 5-chloro-4-(difluoromethoxy)-1-hydroxy-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 142601923 |
| Molecular Formula | C8H6BClF2O3 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | 5-chloro-4-(difluoromethoxy)-1-hydroxy-3H-2,1-benzoxaborole |
| SMILES | OB1OCc2c1ccc(Cl)c2OC(F)F |
| InChI | InChI=1S/C8H6BClF2O3/c10-6-2-1-5-4(3-14-9(5)13)7(6)15-8(11)12/h1-2,8,13H,3H2 |
| InChIKey | GSSUWAKRRMHFCN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|