C17H28NO2+ — CID 11920159
(3,4-dimethoxyphenyl)methyl-[(1R,2R,3R)-2,3-dimethylcyclohexyl]azanium (PubChem CID 11920159) has the molecular formula C17H28NO2+ and a molecular weight of 278.42 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)methyl-[(1R,2R,3R)-2,3-dimethylcyclohexyl]azanium.
| Compound Name | (3,4-dimethoxyphenyl)methyl-[(1R,2R,3R)-2,3-dimethylcyclohexyl]azanium |
|---|---|
| PubChem CID | 11920159 |
| Molecular Formula | C17H28NO2+ |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | (3,4-dimethoxyphenyl)methyl-[(1R,2R,3R)-2,3-dimethylcyclohexyl]azanium |
| SMILES | COc1ccc(C[NH2+][C@@H]2CCC[C@@H](C)[C@H]2C)cc1OC |
| InChI | InChI=1S/C17H27NO2/c1-12-6-5-7-15(13(12)2)18-11-14-8-9-16(19-3)17(10-14)20-4/h8-10,12-13,15,18H,5-7,11H2,1-4H3/p+1/t12-,13-,15-/m1/s1 |
| InChIKey | KITLMAVPVCPDCI-UMVBOHGHSA-O |
| XLogP | 2.59 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |