C16H23BrO2 — CID 107183641
4-[2-bromo-2-(2-methylcyclopentyl)ethyl]-1,2-dimethoxybenzene (PubChem CID 107183641) has the molecular formula C16H23BrO2 and a molecular weight of 327.26 g/mol. Its IUPAC name is 4-[2-bromo-2-(2-methylcyclopentyl)ethyl]-1,2-dimethoxybenzene.
| Compound Name | 4-[2-bromo-2-(2-methylcyclopentyl)ethyl]-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 107183641 |
| Molecular Formula | C16H23BrO2 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 4-[2-bromo-2-(2-methylcyclopentyl)ethyl]-1,2-dimethoxybenzene |
| SMILES | COc1ccc(CC(Br)C2CCCC2C)cc1OC |
| InChI | InChI=1S/C16H23BrO2/c1-11-5-4-6-13(11)14(17)9-12-7-8-15(18-2)16(10-12)19-3/h7-8,10-11,13-14H,4-6,9H2,1-3H3 |
| InChIKey | RAUSYCJCJSHHKY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|