C20H34NO+ — CID 6594061
[(1S,2S,3S)-2,3-dimethylcyclohexyl]-[4-(2,4-dimethylphenoxy)butyl]azanium (PubChem CID 6594061) has the molecular formula C20H34NO+ and a molecular weight of 304.50 g/mol. Its IUPAC name is [(1S,2S,3S)-2,3-dimethylcyclohexyl]-[4-(2,4-dimethylphenoxy)butyl]azanium.
| Compound Name | [(1S,2S,3S)-2,3-dimethylcyclohexyl]-[4-(2,4-dimethylphenoxy)butyl]azanium |
|---|---|
| PubChem CID | 6594061 |
| Molecular Formula | C20H34NO+ |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | [(1S,2S,3S)-2,3-dimethylcyclohexyl]-[4-(2,4-dimethylphenoxy)butyl]azanium |
| SMILES | Cc1ccc(OCCCC[NH2+][C@H]2CCC[C@H](C)[C@@H]2C)c(C)c1 |
| InChI | InChI=1S/C20H33NO/c1-15-10-11-20(17(3)14-15)22-13-6-5-12-21-19-9-7-8-16(2)18(19)4/h10-11,14,16,18-19,21H,5-9,12-13H2,1-4H3/p+1/t16-,18-,19-/m0/s1 |
| InChIKey | JFVXGMCWCRFNIA-WDSOQIARSA-O |
| XLogP | 3.85 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|