C17H27BrNO2+ — CID 8620910
(3-bromo-4,5-dimethoxyphenyl)methyl-cyclooctylazanium (PubChem CID 8620910) has the molecular formula C17H27BrNO2+ and a molecular weight of 357.31 g/mol. Its IUPAC name is (3-bromo-4,5-dimethoxyphenyl)methyl-cyclooctylazanium.
| Compound Name | (3-bromo-4,5-dimethoxyphenyl)methyl-cyclooctylazanium |
|---|---|
| PubChem CID | 8620910 |
| Molecular Formula | C17H27BrNO2+ |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (3-bromo-4,5-dimethoxyphenyl)methyl-cyclooctylazanium |
| SMILES | COc1cc(C[NH2+]C2CCCCCCC2)cc(Br)c1OC |
| InChI | InChI=1S/C17H26BrNO2/c1-20-16-11-13(10-15(18)17(16)21-2)12-19-14-8-6-4-3-5-7-9-14/h10-11,14,19H,3-9,12H2,1-2H3/p+1 |
| InChIKey | VUSGVQIDCWXDSP-UHFFFAOYSA-O |
| XLogP | 3.64 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |