C15H22BrNO3 — CID 62360308
2-[(3-bromo-4,5-dimethoxyphenyl)methylamino]cyclohexan-1-ol (PubChem CID 62360308) has the molecular formula C15H22BrNO3 and a molecular weight of 344.25 g/mol. Its IUPAC name is 2-[(3-bromo-4,5-dimethoxyphenyl)methylamino]cyclohexan-1-ol.
| Compound Name | 2-[(3-bromo-4,5-dimethoxyphenyl)methylamino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 62360308 |
| Molecular Formula | C15H22BrNO3 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 2-[(3-bromo-4,5-dimethoxyphenyl)methylamino]cyclohexan-1-ol |
| SMILES | COc1cc(CNC2CCCCC2O)cc(Br)c1OC |
| InChI | InChI=1S/C15H22BrNO3/c1-19-14-8-10(7-11(16)15(14)20-2)9-17-12-5-3-4-6-13(12)18/h7-8,12-13,17-18H,3-6,9H2,1-2H3 |
| InChIKey | BZTMUSDJTAIILA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |