C19H26BrNO2 — CID 4722276
N-[(3-bromo-4,5-dimethoxyphenyl)methyl]adamantan-2-amine (PubChem CID 4722276) has the molecular formula C19H26BrNO2 and a molecular weight of 380.33 g/mol. Its IUPAC name is N-[(3-bromo-4,5-dimethoxyphenyl)methyl]adamantan-2-amine.
| Compound Name | N-[(3-bromo-4,5-dimethoxyphenyl)methyl]adamantan-2-amine |
|---|---|
| PubChem CID | 4722276 |
| Molecular Formula | C19H26BrNO2 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | N-[(3-bromo-4,5-dimethoxyphenyl)methyl]adamantan-2-amine |
| SMILES | COc1cc(CNC2C3CC4CC(C3)CC2C4)cc(Br)c1OC |
| InChI | InChI=1S/C19H26BrNO2/c1-22-17-9-13(8-16(20)19(17)23-2)10-21-18-14-4-11-3-12(6-14)7-15(18)5-11/h8-9,11-12,14-15,18,21H,3-7,10H2,1-2H3 |
| InChIKey | AGTNILSDDNFECZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |