About N-[(3-bromo-4,5-dimethoxyphenyl)methyl]adamantan-2-amine
N-[(3-bromo-4,5-dimethoxyphenyl)methyl]adamantan-2-amine (PubChem CID 4722276) has the molecular formula C19H26BrNO2
and a molecular weight of 380.33 g/mol. Its IUPAC name is N-[(3-bromo-4,5-dimethoxyphenyl)methyl]adamantan-2-amine.
Molecular Properties
| Compound Name | N-[(3-bromo-4,5-dimethoxyphenyl)methyl]adamantan-2-amine |
| PubChem CID | 4722276 |
| Molecular Formula | C19H26BrNO2 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | N-[(3-bromo-4,5-dimethoxyphenyl)methyl]adamantan-2-amine |
| SMILES | COc1cc(CNC2C3CC4CC(C3)CC2C4)cc(Br)c1OC |
| InChI | InChI=1S/C19H26BrNO2/c1-22-17-9-13(8-16(20)19(17)23-2)10-21-18-14-4-11-3-12(6-14)7-15(18)5-11/h8-9,11-12,14-15,18,21H,3-7,10H2,1-2H3 |
| InChIKey | AGTNILSDDNFECZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3-bromo-4,5-dimethoxyphenyl)methyl]adamantan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-bromo-4,5-dimethoxyphenyl)methyl]adamantan-2-amine?
The IUPAC name of N-[(3-bromo-4,5-dimethoxyphenyl)methyl]adamantan-2-amine (CID 4722276) is N-[(3-bromo-4,5-dimethoxyphenyl)methyl]adamantan-2-amine.
What is the SMILES notation for N-[(3-bromo-4,5-dimethoxyphenyl)methyl]adamantan-2-amine?
The canonical SMILES for N-[(3-bromo-4,5-dimethoxyphenyl)methyl]adamantan-2-amine is COc1cc(CNC2C3CC4CC(C3)CC2C4)cc(Br)c1OC.
What is the InChIKey of N-[(3-bromo-4,5-dimethoxyphenyl)methyl]adamantan-2-amine?
The InChIKey is AGTNILSDDNFECZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26BrNO2/c1-22-17-9-13(8-16(20)19(17)23-2)10-21-18-14-4-11-3-12(6-14)7-15(18)5-11/h8-9,11-12,14-15,18,21H,3-7,10H2,1-2H3.
What are the key properties of N-[(3-bromo-4,5-dimethoxyphenyl)methyl]adamantan-2-amine?
N-[(3-bromo-4,5-dimethoxyphenyl)methyl]adamantan-2-amine has a molecular weight of 380.33 g/mol, XLogP of 4.38, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-bromo-4,5-dimethoxyphenyl)methyl]adamantan-2-amine is sourced from PubChem (CID 4722276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).