C21H29BrN2O3 — CID 4721754
2-[4-[(2-adamantylamino)methyl]-2-bromo-6-ethoxyphenoxy]acetamide (PubChem CID 4721754) has the molecular formula C21H29BrN2O3 and a molecular weight of 437.38 g/mol. Its IUPAC name is 2-[4-[(2-adamantylamino)methyl]-2-bromo-6-ethoxyphenoxy]acetamide.
| Compound Name | 2-[4-[(2-adamantylamino)methyl]-2-bromo-6-ethoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 4721754 |
| Molecular Formula | C21H29BrN2O3 |
| Molecular Weight | 437.38 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 2-[4-[(2-adamantylamino)methyl]-2-bromo-6-ethoxyphenoxy]acetamide |
| SMILES | CCOc1cc(CNC2C3CC4CC(C3)CC2C4)cc(Br)c1OCC(N)=O |
| InChI | InChI=1S/C21H29BrN2O3/c1-2-26-18-9-14(8-17(22)21(18)27-11-19(23)25)10-24-20-15-4-12-3-13(6-15)7-16(20)5-12/h8-9,12-13,15-16,20,24H,2-7,10-11H2,1H3,(H2,23,25) |
| InChIKey | RZLRNJFVJCPAOR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |