C19H20BrCl2FN2O3 — CID 41183350
2-[2-bromo-4-[[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]methyl]-6-ethoxyphenoxy]acetamide (PubChem CID 41183350) has the molecular formula C19H20BrCl2FN2O3 and a molecular weight of 494.19 g/mol. Its IUPAC name is 2-[2-bromo-4-[[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]methyl]-6-ethoxyphenoxy]acetamide.
| Compound Name | 2-[2-bromo-4-[[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]methyl]-6-ethoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 41183350 |
| Molecular Formula | C19H20BrCl2FN2O3 |
| Molecular Weight | 494.19 g/mol |
| Exact Mass | 492.00 |
| IUPAC Name | 2-[2-bromo-4-[[[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]methyl]-6-ethoxyphenoxy]acetamide |
| SMILES | CCOc1cc(CN[C@@H](C)c2cc(F)c(Cl)cc2Cl)cc(Br)c1OCC(N)=O |
| InChI | InChI=1S/C19H20BrCl2FN2O3/c1-3-27-17-5-11(4-13(20)19(17)28-9-18(24)26)8-25-10(2)12-6-16(23)15(22)7-14(12)21/h4-7,10,25H,3,8-9H2,1-2H3,(H2,24,26)/t10-/m0/s1 |
| InChIKey | OPYSLVDTKZRQKD-JTQLQIEISA-N |
| XLogP | 5.01 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.19 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|