C16H23BrN2O4 — CID 653263
2-[2-bromo-6-ethoxy-4-[(oxolan-2-ylmethylamino)methyl]phenoxy]acetamide (PubChem CID 653263) has the molecular formula C16H23BrN2O4 and a molecular weight of 387.27 g/mol. Its IUPAC name is 2-[2-bromo-6-ethoxy-4-[(oxolan-2-ylmethylamino)methyl]phenoxy]acetamide.
| Compound Name | 2-[2-bromo-6-ethoxy-4-[(oxolan-2-ylmethylamino)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 653263 |
| Molecular Formula | C16H23BrN2O4 |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2-[2-bromo-6-ethoxy-4-[(oxolan-2-ylmethylamino)methyl]phenoxy]acetamide |
| SMILES | CCOc1cc(CNCC2CCCO2)cc(Br)c1OCC(N)=O |
| InChI | InChI=1S/C16H23BrN2O4/c1-2-21-14-7-11(8-19-9-12-4-3-5-22-12)6-13(17)16(14)23-10-15(18)20/h6-7,12,19H,2-5,8-10H2,1H3,(H2,18,20) |
| InChIKey | XYPFORSLNGEMME-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |