C21H30ClNO2 — CID 29226070
N-[(3-chloro-5-methoxy-4-propoxyphenyl)methyl]adamantan-2-amine (PubChem CID 29226070) has the molecular formula C21H30ClNO2 and a molecular weight of 363.93 g/mol. Its IUPAC name is N-[(3-chloro-5-methoxy-4-propoxyphenyl)methyl]adamantan-2-amine.
| Compound Name | N-[(3-chloro-5-methoxy-4-propoxyphenyl)methyl]adamantan-2-amine |
|---|---|
| PubChem CID | 29226070 |
| Molecular Formula | C21H30ClNO2 |
| Molecular Weight | 363.93 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | N-[(3-chloro-5-methoxy-4-propoxyphenyl)methyl]adamantan-2-amine |
| SMILES | CCCOc1c(Cl)cc(CNC2C3CC4CC(C3)CC2C4)cc1OC |
| InChI | InChI=1S/C21H30ClNO2/c1-3-4-25-21-18(22)10-15(11-19(21)24-2)12-23-20-16-6-13-5-14(8-16)9-17(20)7-13/h10-11,13-14,16-17,20,23H,3-9,12H2,1-2H3 |
| InChIKey | GZBSLJIXQLCKAQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.93 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |