C17H25ClNO2+ — CID 2215570
(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl-cyclohexylazanium (PubChem CID 2215570) has the molecular formula C17H25ClNO2+ and a molecular weight of 310.85 g/mol. Its IUPAC name is (3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl-cyclohexylazanium.
| Compound Name | (3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl-cyclohexylazanium |
|---|---|
| PubChem CID | 2215570 |
| Molecular Formula | C17H25ClNO2+ |
| Molecular Weight | 310.85 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methyl-cyclohexylazanium |
| SMILES | C=CCOc1c(Cl)cc(C[NH2+]C2CCCCC2)cc1OC |
| InChI | InChI=1S/C17H24ClNO2/c1-3-9-21-17-15(18)10-13(11-16(17)20-2)12-19-14-7-5-4-6-8-14/h3,10-11,14,19H,1,4-9,12H2,2H3/p+1 |
| InChIKey | BFPZTPQKMKMHKA-UHFFFAOYSA-O |
| XLogP | 3.31 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.85 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|