C15H22NO+ — CID 7937281
cyclopentyl-[(3-prop-2-enoxyphenyl)methyl]azanium (PubChem CID 7937281) has the molecular formula C15H22NO+ and a molecular weight of 232.35 g/mol. Its IUPAC name is cyclopentyl-[(3-prop-2-enoxyphenyl)methyl]azanium.
| Compound Name | cyclopentyl-[(3-prop-2-enoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7937281 |
| Molecular Formula | C15H22NO+ |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | cyclopentyl-[(3-prop-2-enoxyphenyl)methyl]azanium |
| SMILES | C=CCOc1cccc(C[NH2+]C2CCCC2)c1 |
| InChI | InChI=1S/C15H21NO/c1-2-10-17-15-9-5-6-13(11-15)12-16-14-7-3-4-8-14/h2,5-6,9,11,14,16H,1,3-4,7-8,10,12H2/p+1 |
| InChIKey | QWZRJGGQGIVLMF-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|