C12H16O — CID 91655995
1-prop-2-enyl-3-propoxybenzene (PubChem CID 91655995) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-prop-2-enyl-3-propoxybenzene.
| Compound Name | 1-prop-2-enyl-3-propoxybenzene |
|---|---|
| PubChem CID | 91655995 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 1-prop-2-enyl-3-propoxybenzene |
| SMILES | C=CCc1cccc(OCCC)c1 |
| InChI | InChI=1S/C12H16O/c1-3-6-11-7-5-8-12(10-11)13-9-4-2/h3,5,7-8,10H,1,4,6,9H2,2H3 |
| InChIKey | PXDARPAZOCKELI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|