About (3-prop-2-enylphenyl) cyanate
(3-prop-2-enylphenyl) cyanate (PubChem CID 23312457) has the molecular formula C10H9NO
and a molecular weight of 159.19 g/mol. Its IUPAC name is (3-prop-2-enylphenyl) cyanate.
Molecular Properties
| Compound Name | (3-prop-2-enylphenyl) cyanate |
| PubChem CID | 23312457 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | (3-prop-2-enylphenyl) cyanate |
| SMILES | C=CCc1cccc(OC#N)c1 |
| InChI | InChI=1S/C10H9NO/c1-2-4-9-5-3-6-10(7-9)12-8-11/h2-3,5-7H,1,4H2 |
| InChIKey | CXHKSCGRFPRWIE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3-prop-2-enylphenyl) cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-prop-2-enylphenyl) cyanate?
The IUPAC name of (3-prop-2-enylphenyl) cyanate (CID 23312457) is (3-prop-2-enylphenyl) cyanate.
What is the SMILES notation for (3-prop-2-enylphenyl) cyanate?
The canonical SMILES for (3-prop-2-enylphenyl) cyanate is C=CCc1cccc(OC#N)c1.
What is the InChIKey of (3-prop-2-enylphenyl) cyanate?
The InChIKey is CXHKSCGRFPRWIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO/c1-2-4-9-5-3-6-10(7-9)12-8-11/h2-3,5-7H,1,4H2.
What are the key properties of (3-prop-2-enylphenyl) cyanate?
(3-prop-2-enylphenyl) cyanate has a molecular weight of 159.19 g/mol, XLogP of 2.27, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-prop-2-enylphenyl) cyanate is sourced from PubChem (CID 23312457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).