About fluoro hydrogen sulfate;1-methoxy-3-prop-2-enylbenzene
fluoro hydrogen sulfate;1-methoxy-3-prop-2-enylbenzene (PubChem CID 175557929) has the molecular formula C10H13FO5S
and a molecular weight of 264.27 g/mol. Its IUPAC name is fluoro hydrogen sulfate;1-methoxy-3-prop-2-enylbenzene.
Molecular Properties
| Compound Name | fluoro hydrogen sulfate;1-methoxy-3-prop-2-enylbenzene |
| PubChem CID | 175557929 |
| Molecular Formula | C10H13FO5S |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | fluoro hydrogen sulfate;1-methoxy-3-prop-2-enylbenzene |
| SMILES | C=CCc1cccc(OC)c1.O=S(=O)(O)OF |
| InChI | InChI=1S/C10H12O.FHO4S/c1-3-5-9-6-4-7-10(8-9)11-2;1-5-6(2,3)4/h3-4,6-8H,1,5H2,2H3;(H,2,3,4) |
| InChIKey | OJMXIZWBZVBGQN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze fluoro hydrogen sulfate;1-methoxy-3-prop-2-enylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro hydrogen sulfate;1-methoxy-3-prop-2-enylbenzene?
The IUPAC name of fluoro hydrogen sulfate;1-methoxy-3-prop-2-enylbenzene (CID 175557929) is fluoro hydrogen sulfate;1-methoxy-3-prop-2-enylbenzene.
What is the SMILES notation for fluoro hydrogen sulfate;1-methoxy-3-prop-2-enylbenzene?
The canonical SMILES for fluoro hydrogen sulfate;1-methoxy-3-prop-2-enylbenzene is C=CCc1cccc(OC)c1.O=S(=O)(O)OF.
What is the InChIKey of fluoro hydrogen sulfate;1-methoxy-3-prop-2-enylbenzene?
The InChIKey is OJMXIZWBZVBGQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O.FHO4S/c1-3-5-9-6-4-7-10(8-9)11-2;1-5-6(2,3)4/h3-4,6-8H,1,5H2,2H3;(H,2,3,4).
What are the key properties of fluoro hydrogen sulfate;1-methoxy-3-prop-2-enylbenzene?
fluoro hydrogen sulfate;1-methoxy-3-prop-2-enylbenzene has a molecular weight of 264.27 g/mol, XLogP of 2.11, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro hydrogen sulfate;1-methoxy-3-prop-2-enylbenzene is sourced from PubChem (CID 175557929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).