About methoxymethane;(3-methoxyphenyl)methanol;prop-1-ene
methoxymethane;(3-methoxyphenyl)methanol;prop-1-ene (PubChem CID 91163567) has the molecular formula C13H22O3
and a molecular weight of 226.32 g/mol. Its IUPAC name is methoxymethane;(3-methoxyphenyl)methanol;prop-1-ene.
Molecular Properties
| Compound Name | methoxymethane;(3-methoxyphenyl)methanol;prop-1-ene |
| PubChem CID | 91163567 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | methoxymethane;(3-methoxyphenyl)methanol;prop-1-ene |
| SMILES | C=CC.COC.COc1cccc(CO)c1 |
| InChI | InChI=1S/C8H10O2.C3H6.C2H6O/c1-10-8-4-2-3-7(5-8)6-9;2*1-3-2/h2-5,9H,6H2,1H3;3H,1H2,2H3;1-2H3 |
| InChIKey | XTRSRVAVFWMMEV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methoxymethane;(3-methoxyphenyl)methanol;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethane;(3-methoxyphenyl)methanol;prop-1-ene?
The IUPAC name of methoxymethane;(3-methoxyphenyl)methanol;prop-1-ene (CID 91163567) is methoxymethane;(3-methoxyphenyl)methanol;prop-1-ene.
What is the SMILES notation for methoxymethane;(3-methoxyphenyl)methanol;prop-1-ene?
The canonical SMILES for methoxymethane;(3-methoxyphenyl)methanol;prop-1-ene is C=CC.COC.COc1cccc(CO)c1.
What is the InChIKey of methoxymethane;(3-methoxyphenyl)methanol;prop-1-ene?
The InChIKey is XTRSRVAVFWMMEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2.C3H6.C2H6O/c1-10-8-4-2-3-7(5-8)6-9;2*1-3-2/h2-5,9H,6H2,1H3;3H,1H2,2H3;1-2H3.
What are the key properties of methoxymethane;(3-methoxyphenyl)methanol;prop-1-ene?
methoxymethane;(3-methoxyphenyl)methanol;prop-1-ene has a molecular weight of 226.32 g/mol, XLogP of 2.64, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;(3-methoxyphenyl)methanol;prop-1-ene is sourced from PubChem (CID 91163567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).