C15H22O4 — CID 24769985
(2S,3S,4S)-3-ethenyl-4-[(3-methoxyphenyl)methyl]pentane-1,2,5-triol (PubChem CID 24769985) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (2S,3S,4S)-3-ethenyl-4-[(3-methoxyphenyl)methyl]pentane-1,2,5-triol.
| Compound Name | (2S,3S,4S)-3-ethenyl-4-[(3-methoxyphenyl)methyl]pentane-1,2,5-triol |
|---|---|
| PubChem CID | 24769985 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (2S,3S,4S)-3-ethenyl-4-[(3-methoxyphenyl)methyl]pentane-1,2,5-triol |
| SMILES | C=C[C@@H]([C@@H](CO)Cc1cccc(OC)c1)[C@H](O)CO |
| InChI | InChI=1S/C15H22O4/c1-3-14(15(18)10-17)12(9-16)7-11-5-4-6-13(8-11)19-2/h3-6,8,12,14-18H,1,7,9-10H2,2H3/t12-,14+,15-/m1/s1 |
| InChIKey | ZEZMKJHTSRXZLW-VHDGCEQUSA-N |
| XLogP | 1.00 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|