C26H38O8 — CID 141459539
(2S,3R,4R,5R)-10-(3-methoxyphenyl)-7-[(3-methoxyphenyl)methyl]-9-methyldecane-1,2,3,4,5,6-hexol (PubChem CID 141459539) has the molecular formula C26H38O8 and a molecular weight of 478.58 g/mol. Its IUPAC name is (2S,3R,4R,5R)-10-(3-methoxyphenyl)-7-[(3-methoxyphenyl)methyl]-9-methyldecane-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3R,4R,5R)-10-(3-methoxyphenyl)-7-[(3-methoxyphenyl)methyl]-9-methyldecane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141459539 |
| Molecular Formula | C26H38O8 |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | (2S,3R,4R,5R)-10-(3-methoxyphenyl)-7-[(3-methoxyphenyl)methyl]-9-methyldecane-1,2,3,4,5,6-hexol |
| SMILES | COc1cccc(CC(C)CC(Cc2cccc(OC)c2)C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO)c1 |
| InChI | InChI=1S/C26H38O8/c1-16(10-17-6-4-8-20(13-17)33-2)11-19(12-18-7-5-9-21(14-18)34-3)23(29)25(31)26(32)24(30)22(28)15-27/h4-9,13-14,16,19,22-32H,10-12,15H2,1-3H3/t16?,19?,22-,23?,24+,25+,26-/m0/s1 |
| InChIKey | XDHGYTZWZRTFMG-XGZBJJJISA-N |
| XLogP | 0.93 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |