C30H46O6 — CID 141460159
(2S,3R,4R,5R)-9-methyl-10-(3-propylphenyl)-7-[(3-propylphenyl)methyl]decane-1,2,3,4,5,6-hexol (PubChem CID 141460159) has the molecular formula C30H46O6 and a molecular weight of 502.69 g/mol. Its IUPAC name is (2S,3R,4R,5R)-9-methyl-10-(3-propylphenyl)-7-[(3-propylphenyl)methyl]decane-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3R,4R,5R)-9-methyl-10-(3-propylphenyl)-7-[(3-propylphenyl)methyl]decane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141460159 |
| Molecular Formula | C30H46O6 |
| Molecular Weight | 502.69 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | (2S,3R,4R,5R)-9-methyl-10-(3-propylphenyl)-7-[(3-propylphenyl)methyl]decane-1,2,3,4,5,6-hexol |
| SMILES | CCCc1cccc(CC(C)CC(Cc2cccc(CCC)c2)C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO)c1 |
| InChI | InChI=1S/C30H46O6/c1-4-8-21-10-6-12-23(16-21)14-20(3)15-25(18-24-13-7-11-22(17-24)9-5-2)27(33)29(35)30(36)28(34)26(32)19-31/h6-7,10-13,16-17,20,25-36H,4-5,8-9,14-15,18-19H2,1-3H3/t20?,25?,26-,27?,28+,29+,30-/m0/s1 |
| InChIKey | BNHDPOAXCLVHKA-WSBONATHSA-N |
| XLogP | 2.82 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.69 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |