C28H42O10 — CID 141459582
(2S,3R,4R,5R)-10-(2,3-dimethoxyphenyl)-7-[(2,3-dimethoxyphenyl)methyl]-9-methyldecane-1,2,3,4,5,6-hexol (PubChem CID 141459582) has the molecular formula C28H42O10 and a molecular weight of 538.63 g/mol. Its IUPAC name is (2S,3R,4R,5R)-10-(2,3-dimethoxyphenyl)-7-[(2,3-dimethoxyphenyl)methyl]-9-methyldecane-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3R,4R,5R)-10-(2,3-dimethoxyphenyl)-7-[(2,3-dimethoxyphenyl)methyl]-9-methyldecane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141459582 |
| Molecular Formula | C28H42O10 |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | (2S,3R,4R,5R)-10-(2,3-dimethoxyphenyl)-7-[(2,3-dimethoxyphenyl)methyl]-9-methyldecane-1,2,3,4,5,6-hexol |
| SMILES | COc1cccc(CC(C)CC(Cc2cccc(OC)c2OC)C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO)c1OC |
| InChI | InChI=1S/C28H42O10/c1-16(12-17-8-6-10-21(35-2)27(17)37-4)13-19(14-18-9-7-11-22(36-3)28(18)38-5)23(31)25(33)26(34)24(32)20(30)15-29/h6-11,16,19-20,23-26,29-34H,12-15H2,1-5H3/t16?,19?,20-,23?,24+,25+,26-/m0/s1 |
| InChIKey | MRSKWRPQSVLROF-ANUWDTLPSA-N |
| XLogP | 0.95 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |