C32H50O6 — CID 141459775
(2S,3R,4R,5R)-10-(4-butylphenyl)-7-[(4-butylphenyl)methyl]-9-methyldecane-1,2,3,4,5,6-hexol (PubChem CID 141459775) has the molecular formula C32H50O6 and a molecular weight of 530.75 g/mol. Its IUPAC name is (2S,3R,4R,5R)-10-(4-butylphenyl)-7-[(4-butylphenyl)methyl]-9-methyldecane-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3R,4R,5R)-10-(4-butylphenyl)-7-[(4-butylphenyl)methyl]-9-methyldecane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141459775 |
| Molecular Formula | C32H50O6 |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | (2S,3R,4R,5R)-10-(4-butylphenyl)-7-[(4-butylphenyl)methyl]-9-methyldecane-1,2,3,4,5,6-hexol |
| SMILES | CCCCc1ccc(CC(C)CC(Cc2ccc(CCCC)cc2)C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO)cc1 |
| InChI | InChI=1S/C32H50O6/c1-4-6-8-23-10-14-25(15-11-23)18-22(3)19-27(20-26-16-12-24(13-17-26)9-7-5-2)29(35)31(37)32(38)30(36)28(34)21-33/h10-17,22,27-38H,4-9,18-21H2,1-3H3/t22?,27?,28-,29?,30+,31+,32-/m0/s1 |
| InChIKey | DCFAZZXGRLZVKT-YSLKTMGLSA-N |
| XLogP | 3.60 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |