C24H28F6O6 — CID 141459816
(2S,3R,4R,5R)-9-methyl-10-(2,3,5-trifluorophenyl)-7-[(2,3,5-trifluorophenyl)methyl]decane-1,2,3,4,5,6-hexol (PubChem CID 141459816) has the molecular formula C24H28F6O6 and a molecular weight of 526.47 g/mol. Its IUPAC name is (2S,3R,4R,5R)-9-methyl-10-(2,3,5-trifluorophenyl)-7-[(2,3,5-trifluorophenyl)methyl]decane-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3R,4R,5R)-9-methyl-10-(2,3,5-trifluorophenyl)-7-[(2,3,5-trifluorophenyl)methyl]decane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141459816 |
| Molecular Formula | C24H28F6O6 |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | (2S,3R,4R,5R)-9-methyl-10-(2,3,5-trifluorophenyl)-7-[(2,3,5-trifluorophenyl)methyl]decane-1,2,3,4,5,6-hexol |
| SMILES | CC(Cc1cc(F)cc(F)c1F)CC(Cc1cc(F)cc(F)c1F)C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C24H28F6O6/c1-10(2-11-5-14(25)7-16(27)19(11)29)3-13(4-12-6-15(26)8-17(28)20(12)30)21(33)23(35)24(36)22(34)18(32)9-31/h5-8,10,13,18,21-24,31-36H,2-4,9H2,1H3/t10?,13?,18-,21?,22+,23+,24-/m0/s1 |
| InChIKey | WDHRWXZYYHHURX-WSZKCILSSA-N |
| XLogP | 1.75 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|