C24H32F2O6 — CID 141459937
(2S,3R,4R,5R)-10-(2-fluorophenyl)-7-[(2-fluorophenyl)methyl]-9-methyldecane-1,2,3,4,5,6-hexol (PubChem CID 141459937) has the molecular formula C24H32F2O6 and a molecular weight of 454.51 g/mol. Its IUPAC name is (2S,3R,4R,5R)-10-(2-fluorophenyl)-7-[(2-fluorophenyl)methyl]-9-methyldecane-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3R,4R,5R)-10-(2-fluorophenyl)-7-[(2-fluorophenyl)methyl]-9-methyldecane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141459937 |
| Molecular Formula | C24H32F2O6 |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | (2S,3R,4R,5R)-10-(2-fluorophenyl)-7-[(2-fluorophenyl)methyl]-9-methyldecane-1,2,3,4,5,6-hexol |
| SMILES | CC(Cc1ccccc1F)CC(Cc1ccccc1F)C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C24H32F2O6/c1-14(10-15-6-2-4-8-18(15)25)11-17(12-16-7-3-5-9-19(16)26)21(29)23(31)24(32)22(30)20(28)13-27/h2-9,14,17,20-24,27-32H,10-13H2,1H3/t14?,17?,20-,21?,22+,23+,24-/m0/s1 |
| InChIKey | SVWDKAFTYNSCSE-QRSAOTPQSA-N |
| XLogP | 1.19 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |