C14H20O — CID 126489202
3-methyl-4-(3-propylphenyl)butan-2-one (PubChem CID 126489202) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is 3-methyl-4-(3-propylphenyl)butan-2-one.
| Compound Name | 3-methyl-4-(3-propylphenyl)butan-2-one |
|---|---|
| PubChem CID | 126489202 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 3-methyl-4-(3-propylphenyl)butan-2-one |
| SMILES | CCCc1cccc(CC(C)C(C)=O)c1 |
| InChI | InChI=1S/C14H20O/c1-4-6-13-7-5-8-14(10-13)9-11(2)12(3)15/h5,7-8,10-11H,4,6,9H2,1-3H3 |
| InChIKey | CVJWPLGRRSVWJA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |