C29H36O5 — CID 137475002
3-[3-[2-acetyl-2-[[3-(2-methyl-3-oxobutyl)phenyl]methyl]-3-oxobutyl]phenyl]-2,2-dimethylpropanoic acid (PubChem CID 137475002) has the molecular formula C29H36O5 and a molecular weight of 464.60 g/mol. Its IUPAC name is 3-[3-[2-acetyl-2-[[3-(2-methyl-3-oxobutyl)phenyl]methyl]-3-oxobutyl]phenyl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[3-[2-acetyl-2-[[3-(2-methyl-3-oxobutyl)phenyl]methyl]-3-oxobutyl]phenyl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 137475002 |
| Molecular Formula | C29H36O5 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | 3-[3-[2-acetyl-2-[[3-(2-methyl-3-oxobutyl)phenyl]methyl]-3-oxobutyl]phenyl]-2,2-dimethylpropanoic acid |
| SMILES | CC(=O)C(C)Cc1cccc(CC(Cc2cccc(CC(C)(C)C(=O)O)c2)(C(C)=O)C(C)=O)c1 |
| InChI | InChI=1S/C29H36O5/c1-19(20(2)30)13-23-9-7-11-25(14-23)17-29(21(3)31,22(4)32)18-26-12-8-10-24(15-26)16-28(5,6)27(33)34/h7-12,14-15,19H,13,16-18H2,1-6H3,(H,33,34) |
| InChIKey | QCHMHJVZKHNCEI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|