C16H26O — CID 15830826
(2S,4R,6S)-2,4,6-trimethyl-7-phenylheptan-1-ol (PubChem CID 15830826) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is (2S,4R,6S)-2,4,6-trimethyl-7-phenylheptan-1-ol.
| Compound Name | (2S,4R,6S)-2,4,6-trimethyl-7-phenylheptan-1-ol |
|---|---|
| PubChem CID | 15830826 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | (2S,4R,6S)-2,4,6-trimethyl-7-phenylheptan-1-ol |
| SMILES | C[C@@H](C[C@H](C)CO)C[C@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C16H26O/c1-13(10-15(3)12-17)9-14(2)11-16-7-5-4-6-8-16/h4-8,13-15,17H,9-12H2,1-3H3/t13-,14+,15+/m1/s1 |
| InChIKey | OSOTVQBNVRTOFT-ILXRZTDVSA-N |
| XLogP | 3.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |