C13H19I — CID 11001118
[(2S,4R)-5-iodo-2,4-dimethylpentyl]benzene (PubChem CID 11001118) has the molecular formula C13H19I and a molecular weight of 302.20 g/mol. Its IUPAC name is [(2S,4R)-5-iodo-2,4-dimethylpentyl]benzene.
| Compound Name | [(2S,4R)-5-iodo-2,4-dimethylpentyl]benzene |
|---|---|
| PubChem CID | 11001118 |
| Molecular Formula | C13H19I |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | [(2S,4R)-5-iodo-2,4-dimethylpentyl]benzene |
| SMILES | C[C@H](Cc1ccccc1)C[C@@H](C)CI |
| InChI | InChI=1S/C13H19I/c1-11(8-12(2)10-14)9-13-6-4-3-5-7-13/h3-7,11-12H,8-10H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | JYOLKKREBPVZMI-NWDGAFQWSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|