C10H15NO2 — CID 28804581
(2S)-2-amino-3-(3-methoxyphenyl)propan-1-ol (PubChem CID 28804581) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is (2S)-2-amino-3-(3-methoxyphenyl)propan-1-ol.
| Compound Name | (2S)-2-amino-3-(3-methoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 28804581 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (2S)-2-amino-3-(3-methoxyphenyl)propan-1-ol |
| SMILES | COc1cccc(C[C@H](N)CO)c1 |
| InChI | InChI=1S/C10H15NO2/c1-13-10-4-2-3-8(6-10)5-9(11)7-12/h2-4,6,9,12H,5,7,11H2,1H3/t9-/m0/s1 |
| InChIKey | MQFQMJOLDYSYPT-VIFPVBQESA-N |
| XLogP | 0.56 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |