C12H19NO — CID 89063549
(2S)-1-(3-methoxyphenyl)pentan-2-amine (PubChem CID 89063549) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (2S)-1-(3-methoxyphenyl)pentan-2-amine.
| Compound Name | (2S)-1-(3-methoxyphenyl)pentan-2-amine |
|---|---|
| PubChem CID | 89063549 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (2S)-1-(3-methoxyphenyl)pentan-2-amine |
| SMILES | CCC[C@H](N)Cc1cccc(OC)c1 |
| InChI | InChI=1S/C12H19NO/c1-3-5-11(13)8-10-6-4-7-12(9-10)14-2/h4,6-7,9,11H,3,5,8,13H2,1-2H3/t11-/m0/s1 |
| InChIKey | VCIQOQRZVUSZCQ-NSHDSACASA-N |
| XLogP | 2.37 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |