C14H18O — CID 143526233
1-[(Z,2Z)-2-ethylidenepent-3-enyl]-3-methoxybenzene (PubChem CID 143526233) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-[(Z,2Z)-2-ethylidenepent-3-enyl]-3-methoxybenzene.
| Compound Name | 1-[(Z,2Z)-2-ethylidenepent-3-enyl]-3-methoxybenzene |
|---|---|
| PubChem CID | 143526233 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 1-[(Z,2Z)-2-ethylidenepent-3-enyl]-3-methoxybenzene |
| SMILES | C/C=C\C(=C/C)Cc1cccc(OC)c1 |
| InChI | InChI=1S/C14H18O/c1-4-7-12(5-2)10-13-8-6-9-14(11-13)15-3/h4-9,11H,10H2,1-3H3/b7-4-,12-5+ |
| InChIKey | MKQYVYBKIAFNAY-FKBQNAHWSA-N |
| XLogP | 3.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|