C15H21N2OP — CID 143526232
aminophosphanylformonitrile;1-[(Z,2Z)-2-ethylidenepent-3-enyl]-3-methoxybenzene (PubChem CID 143526232) has the molecular formula C15H21N2OP and a molecular weight of 276.32 g/mol. Its IUPAC name is aminophosphanylformonitrile;1-[(Z,2Z)-2-ethylidenepent-3-enyl]-3-methoxybenzene.
| Compound Name | aminophosphanylformonitrile;1-[(Z,2Z)-2-ethylidenepent-3-enyl]-3-methoxybenzene |
|---|---|
| PubChem CID | 143526232 |
| Molecular Formula | C15H21N2OP |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | aminophosphanylformonitrile;1-[(Z,2Z)-2-ethylidenepent-3-enyl]-3-methoxybenzene |
| SMILES | C/C=C\C(=C/C)Cc1cccc(OC)c1.N#CPN |
| InChI | InChI=1S/C14H18O.CH3N2P/c1-4-7-12(5-2)10-13-8-6-9-14(11-13)15-3;2-1-4-3/h4-9,11H,10H2,1-3H3;4H,3H2/b7-4-,12-5+; |
| InChIKey | FTYFZCLXZAMDCZ-VACVELDKSA-N |
| XLogP | 3.78 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|