About (3-propoxyphenyl)borane
(3-propoxyphenyl)borane (PubChem CID 137330417) has the molecular formula C9H13BO
and a molecular weight of 148.01 g/mol. Its IUPAC name is (3-propoxyphenyl)borane.
Molecular Properties
| Compound Name | (3-propoxyphenyl)borane |
| PubChem CID | 137330417 |
| Molecular Formula | C9H13BO |
| Molecular Weight | 148.01 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | (3-propoxyphenyl)borane |
| SMILES | Bc1cccc(OCCC)c1 |
| InChI | InChI=1S/C9H13BO/c1-2-6-11-9-5-3-4-8(10)7-9/h3-5,7H,2,6,10H2,1H3 |
| InChIKey | CTQNKBARRRWYCX-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.01 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3-propoxyphenyl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-propoxyphenyl)borane?
The IUPAC name of (3-propoxyphenyl)borane (CID 137330417) is (3-propoxyphenyl)borane.
What is the SMILES notation for (3-propoxyphenyl)borane?
The canonical SMILES for (3-propoxyphenyl)borane is Bc1cccc(OCCC)c1.
What is the InChIKey of (3-propoxyphenyl)borane?
The InChIKey is CTQNKBARRRWYCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BO/c1-2-6-11-9-5-3-4-8(10)7-9/h3-5,7H,2,6,10H2,1H3.
What are the key properties of (3-propoxyphenyl)borane?
(3-propoxyphenyl)borane has a molecular weight of 148.01 g/mol, XLogP of 0.73, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-propoxyphenyl)borane is sourced from PubChem (CID 137330417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).