C14H18O2 — CID 153464042
1-(cyclobutyloxymethyl)-3-prop-2-enoxybenzene (PubChem CID 153464042) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-(cyclobutyloxymethyl)-3-prop-2-enoxybenzene.
| Compound Name | 1-(cyclobutyloxymethyl)-3-prop-2-enoxybenzene |
|---|---|
| PubChem CID | 153464042 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 1-(cyclobutyloxymethyl)-3-prop-2-enoxybenzene |
| SMILES | C=CCOc1cccc(COC2CCC2)c1 |
| InChI | InChI=1S/C14H18O2/c1-2-9-15-14-8-3-5-12(10-14)11-16-13-6-4-7-13/h2-3,5,8,10,13H,1,4,6-7,9,11H2 |
| InChIKey | BVJCDXWPHYCCQY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|