C12H16N2O2 — CID 63570894
3-(cyclobutyloxymethyl)benzohydrazide (PubChem CID 63570894) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 3-(cyclobutyloxymethyl)benzohydrazide.
| Compound Name | 3-(cyclobutyloxymethyl)benzohydrazide |
|---|---|
| PubChem CID | 63570894 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 3-(cyclobutyloxymethyl)benzohydrazide |
| SMILES | NNC(=O)c1cccc(COC2CCC2)c1 |
| InChI | InChI=1S/C12H16N2O2/c13-14-12(15)10-4-1-3-9(7-10)8-16-11-5-2-6-11/h1,3-4,7,11H,2,5-6,8,13H2,(H,14,15) |
| InChIKey | NCFMCLDRNUIAKX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|