C10H14N2O3 — CID 63568578
5-(cyclobutyloxymethyl)furan-2-carbohydrazide (PubChem CID 63568578) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 5-(cyclobutyloxymethyl)furan-2-carbohydrazide.
| Compound Name | 5-(cyclobutyloxymethyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 63568578 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 5-(cyclobutyloxymethyl)furan-2-carbohydrazide |
| SMILES | NNC(=O)c1ccc(COC2CCC2)o1 |
| InChI | InChI=1S/C10H14N2O3/c11-12-10(13)9-5-4-8(15-9)6-14-7-2-1-3-7/h4-5,7H,1-3,6,11H2,(H,12,13) |
| InChIKey | HNZJOZUBNNHTCO-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|