C20H30N2O5 — CID 143550084
5-[[(4R,12S)-4,12-dimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-yl]oxymethyl]furan-2-carbohydrazide (PubChem CID 143550084) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is 5-[[(4R,12S)-4,12-dimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-yl]oxymethyl]furan-2-carbohydrazide.
| Compound Name | 5-[[(4R,12S)-4,12-dimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-yl]oxymethyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 143550084 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 5-[[(4R,12S)-4,12-dimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-yl]oxymethyl]furan-2-carbohydrazide |
| SMILES | C[C@H]1C(OCc2ccc(C(=O)NN)o2)OC2O[C@@H](C)CCC3CCCC1C32 |
| InChI | InChI=1S/C20H30N2O5/c1-11-6-7-13-4-3-5-15-12(2)19(27-20(25-11)17(13)15)24-10-14-8-9-16(26-14)18(23)22-21/h8-9,11-13,15,17,19-20H,3-7,10,21H2,1-2H3,(H,22,23)/t11-,12+,13?,15?,17?,19?,20?/m0/s1 |
| InChIKey | KIASNPYDXJIUJN-ZXAQMXJNSA-N |
| XLogP | 2.95 |
| TPSA | 95.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|