C21H30O6 — CID 176696945
5-[[(1S,3S,4R,5S,8R,9S)-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-yl]oxymethyl]furan-2-carboxylic acid (PubChem CID 176696945) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is 5-[[(1S,3S,4R,5S,8R,9S)-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-yl]oxymethyl]furan-2-carboxylic acid.
| Compound Name | 5-[[(1S,3S,4R,5S,8R,9S)-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-yl]oxymethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 176696945 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 5-[[(1S,3S,4R,5S,8R,9S)-4,8,12-trimethyl-2,13-dioxatricyclo[7.4.1.05,14]tetradecan-3-yl]oxymethyl]furan-2-carboxylic acid |
| SMILES | CC1CCC2C3[C@@H](O1)O[C@H](OCc1ccc(C(=O)O)o1)[C@H](C)[C@@H]3CC[C@H]2C |
| InChI | InChI=1S/C21H30O6/c1-11-4-7-16-13(3)20(24-10-14-6-9-17(26-14)19(22)23)27-21-18(16)15(11)8-5-12(2)25-21/h6,9,11-13,15-16,18,20-21H,4-5,7-8,10H2,1-3H3,(H,22,23)/t11-,12?,13-,15?,16+,18?,20+,21+/m1/s1 |
| InChIKey | FTGNFOHBCOXMTA-ZQGLBQMVSA-N |
| XLogP | 4.29 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |